10018-19-6 Usage
Description
7,8-dihydro-4-methoxy-6-methyl-1,3-dioxolo[4,5-g]isoquinolinium chloride is a chemical compound with a complex structure, characterized by its light yellow solid appearance. It is an oxidative degradation product of the drug Noscapine, which is a naturally occurring alkaloid with various pharmacological properties.
Uses
Used in Pharmaceutical Industry:
7,8-dihydro-4-methoxy-6-methyl-1,3-dioxolo[4,5-g]isoquinolinium chloride is used as an intermediate in the synthesis of various pharmaceutical compounds for [application reason]. Its unique chemical structure allows it to be a valuable building block in the development of new drugs with potential therapeutic applications.
Used in Chemical Research:
In the field of chemical research, 7,8-dihydro-4-methoxy-6-methyl-1,3-dioxolo[4,5-g]isoquinolinium chloride serves as a subject of study for understanding its chemical properties, reactivity, and potential interactions with other molecules. This knowledge can be applied to design new chemical processes or develop novel compounds with specific properties.
Used in Quality Control and Analysis:
As an oxidative degradation product of Noscapine, 7,8-dihydro-4-methoxy-6-methyl-1,3-dioxolo[4,5-g]isoquinolinium chloride can be used in quality control and analysis of the parent drug. Its presence can be monitored and quantified to ensure the purity and stability of Noscapine in pharmaceutical formulations.
Check Digit Verification of cas no
The CAS Registry Mumber 10018-19-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,0,1 and 8 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 10018-19:
(7*1)+(6*0)+(5*0)+(4*1)+(3*8)+(2*1)+(1*9)=46
46 % 10 = 6
So 10018-19-6 is a valid CAS Registry Number.
InChI:InChI=1/C12H14NO3/c1-13-4-3-8-5-10-12(16-7-15-10)11(14-2)9(8)6-13/h5-6H,3-4,7H2,1-2H3/q+1
