1002726-62-6 Usage
Description
6-AMINO-2,2-DIMETHYL-2H-PYRIDO[3,2-B][1,4]OXAZIN-3(4H)-ONE is a chemical compound that serves as a crucial intermediate in the synthesis of certain pharmaceuticals. It is characterized by its unique molecular structure, which includes an amino group, a dimethyl group, and a pyridooxazinone ring. 6-AMINO-2,2-DIMETHYL-2H-PYRIDO[3,2-B][1,4]OXAZIN-3(4H)-ONE plays a significant role in the development of protein kinase inhibitors, which are essential in the treatment of various diseases.
Uses
Used in Pharmaceutical Industry:
6-AMINO-2,2-DIMETHYL-2H-PYRIDO[3,2-B][1,4]OXAZIN-3(4H)-ONE is used as a key intermediate for the preparation of protein kinase inhibitors. These inhibitors are essential in the development of medications that target specific enzymes involved in cellular signaling pathways, which can lead to the regulation of various diseases.
Used in the Development of Fostamatinib:
6-AMINO-2,2-DIMETHYL-2H-PYRIDO[3,2-B][1,4]OXAZIN-3(4H)-ONE is the key intermediate of Fostamatinib, a medication approved by the U.S. Food and Drug Administration since 2018 for the treatment of chronic immune thrombocytopenia (ITP). ITP is a rare autoimmune disorder characterized by low blood platelet count, which can lead to excessive bleeding. Fostamatinib works by inhibiting the spleen's destruction of platelets, thereby increasing their count and reducing the risk of bleeding in patients with ITP.
Check Digit Verification of cas no
The CAS Registry Mumber 1002726-62-6 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,0,0,2,7,2 and 6 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 1002726-62:
(9*1)+(8*0)+(7*0)+(6*2)+(5*7)+(4*2)+(3*6)+(2*6)+(1*2)=96
96 % 10 = 6
So 1002726-62-6 is a valid CAS Registry Number.
InChI:InChI=1S/C9H11N3O2/c1-9(2)8(13)12-7-5(14-9)3-4-6(10)11-7/h3-4H,1-2H3,(H3,10,11,12,13)
