100962-02-5 Usage
Description
4-(2-Quinoxalinylamino)benzenecarboxylic acid, also known as QNBAC, is a chemical compound with potential applications in the pharmaceutical industry. It is a derivative of quinoxaline and contains a carboxylic acid group, making it a potential candidate for the development of drugs targeting specific receptors or enzymes in the body. QNBAC has been studied for its potential anti-inflammatory and analgesic properties, as well as its potential to inhibit certain enzymes involved in disease processes. Its unique structure and potential biological activities make it an interesting compound for further research and development in the field of medicinal chemistry.
Uses
Used in Pharmaceutical Industry:
4-(2-Quinoxalinylamino)benzenecarboxylic acid is used as a potential drug candidate for the development of medications targeting specific receptors or enzymes in the body. Its unique structure and potential biological activities make it a promising compound for the treatment of various diseases and conditions.
Used in Anti-inflammatory and Analgesic Applications:
4-(2-Quinoxalinylamino)benzenecarboxylic acid is used as an anti-inflammatory and analgesic agent, potentially providing relief from pain and reducing inflammation in various conditions.
Used in Enzyme Inhibition:
4-(2-Quinoxalinylamino)benzenecarboxylic acid is used as an enzyme inhibitor, potentially inhibiting certain enzymes involved in disease processes and contributing to the development of novel therapeutic agents for the treatment of various diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 100962-02-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,0,9,6 and 2 respectively; the second part has 2 digits, 0 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 100962-02:
(8*1)+(7*0)+(6*0)+(5*9)+(4*6)+(3*2)+(2*0)+(1*2)=85
85 % 10 = 5
So 100962-02-5 is a valid CAS Registry Number.
InChI:InChI=1/C15H11N3O2/c19-15(20)10-5-7-11(8-6-10)17-14-9-16-12-3-1-2-4-13(12)18-14/h1-9H,(H,17,18)(H,19,20)
