10252-89-8 Usage
General Description
3-(5-CHLORO-1H-BENZO[D]IMIDAZOL-2-YL)PROPAN-1-OL is a chemical compound with the molecular formula C11H12ClN3O. It is a derivative of benzo[d]imidazole with a chloro substituent at the 5-position and a propan-1-ol group attached to the 3-position. 3-(5-CHLORO-1H-BENZO[D]IMIDAZOL-2-YL)PROPAN-1-OL may have applications in pharmaceutical or chemical research due to its unique structure and potential biological activity. Its specific properties and uses would need to be further investigated through experimentation and analysis.
Check Digit Verification of cas no
The CAS Registry Mumber 10252-89-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,2,5 and 2 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 10252-89:
(7*1)+(6*0)+(5*2)+(4*5)+(3*2)+(2*8)+(1*9)=68
68 % 10 = 8
So 10252-89-8 is a valid CAS Registry Number.
InChI:InChI=1/C10H11ClN2O/c11-7-3-4-8-9(6-7)13-10(12-8)2-1-5-14/h3-4,6,14H,1-2,5H2,(H,12,13)