10308-82-4 Usage
Description
Aminoguanidinium nitrate is a white, fine crystalline powder that serves as a crucial compound in the pharmaceutical industry due to its versatile applications in the synthesis of various therapeutic agents.
Uses
Used in Pharmaceutical Industry:
Aminoguanidinium nitrate is used as a pharmaceutical raw material for the synthesis of inhibitors of cathepsin L, which play a significant role in tumor suppression and treatment. These inhibitors help in the development of potential cancer therapies by targeting a specific enzyme involved in tumor growth and metastasis.
Aminoguanidinium nitrate is also used in the synthesis of melanocortin-4 receptor agonists, which are potential anti-obesity agents. These agonists work by modulating the melanocortin system, which is involved in regulating energy balance and appetite, thus offering a promising approach to combat obesity and related metabolic disorders.
Check Digit Verification of cas no
The CAS Registry Mumber 10308-82-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,3,0 and 8 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 10308-82:
(7*1)+(6*0)+(5*3)+(4*0)+(3*8)+(2*8)+(1*2)=64
64 % 10 = 4
So 10308-82-4 is a valid CAS Registry Number.
InChI:InChI=1/CH6N4.H2NO3/c2-1(3)5-4;2-1(3)4/h4H2,(H4,2,3,5);(H2,2,3,4)/q;+1
