10369-83-2 Usage
Description
2-Diethylaminoethyl hexanoate, also known as a soybean herbicidal safener, is a chemical compound with the appearance of a white powder. It is primarily used in the agricultural industry to enhance the selectivity and safety of herbicides, particularly for soybeans. 2-Diethylaminoethyl hexanoate functions by protecting the crop from potential herbicide damage, allowing for more effective weed control without harming the soybean plants.
Uses
Used in Agricultural Industry:
2-Diethylaminoethyl hexanoate is used as a safening agent for soybeans to protect them from the harmful effects of certain herbicides. It enhances the selectivity of the herbicides, ensuring that they target weeds while minimizing damage to the crop. This application reason is due to the compound's ability to counteract the negative effects of herbicides on soybean plants, allowing for more effective weed control and improved crop yield.
Additionally, 2-Diethylaminoethyl hexanoate may have other potential applications in various industries, such as pharmaceuticals or chemical manufacturing, due to its unique chemical properties.
Check Digit Verification of cas no
The CAS Registry Mumber 10369-83-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,3,6 and 9 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 10369-83:
(7*1)+(6*0)+(5*3)+(4*6)+(3*9)+(2*8)+(1*3)=92
92 % 10 = 2
So 10369-83-2 is a valid CAS Registry Number.
InChI:InChI=1/C12H25NO2/c1-4-7-8-9-12(14)15-11-10-13(5-2)6-3/h4-11H2,1-3H3