103775-75-3 Usage
Description
Miboplatin is a platinum coordination complex that has been identified and developed as a new antitumor agent in Japan. It is a promising pharmaceutical candidate for various applications in the medical field due to its unique chemical properties and potential to combat cancer cells.
Uses
Used in Anticancer Applications:
Miboplatin is used as an antitumor agent for the treatment of various types of cancer. It has been specifically developed to target and eliminate cancer cells, making it a valuable addition to the arsenal of cancer-fighting drugs. The platinum coordination complex in Miboplatin allows it to interact with the DNA of cancer cells, leading to the inhibition of their growth and proliferation.
Used in Pharmaceutical Industry:
Miboplatin is used as a key component in the development of new cancer treatments. Its unique properties and effectiveness against various types of cancer make it an important asset in the ongoing research and development of innovative pharmaceuticals. The pharmaceutical industry continues to explore the potential of Miboplatin and other platinum coordination complexes to create more effective and targeted cancer therapies.
Check Digit Verification of cas no
The CAS Registry Mumber 103775-75-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,3,7,7 and 5 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 103775-75:
(8*1)+(7*0)+(6*3)+(5*7)+(4*7)+(3*5)+(2*7)+(1*5)=123
123 % 10 = 3
So 103775-75-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H8O4.C5H12N2.Pt/c7-4(8)6(5(9)10)2-1-3-6;6-4-5-2-1-3-7-5;/h1-3H2,(H,7,8)(H,9,10);5,7H,1-4,6H2;/q;;+2/p-2/t;5-;/m.1./s1
