10378-23-1 Usage
Description
Ethylenediaminetetraacetic acid tetrasodium salt dihydrate, commonly known as EDTA, is a synthetic amino acid derivative that acts as a strong chelating agent for metal ions. It is characterized by its white crystalline or powdery appearance and possesses antibacterial properties. EDTA is known for its ability to remove undesirable effects of ferric, cupric, and manganic ions in bleaching processes, inhibit metalloprotease activity, and prevent cellular division, chlorophyll synthesis, and algal biomass production. Additionally, it exhibits anticoagulant properties.
Uses
Used in Biomedical Applications:
Ethylenediaminetetraacetic acid tetrasodium salt dihydrate is used as a chelating agent for the isolation of various cell types, including human endometrial stem cells/stromal cells (hEnSCs) from menstrual blood, animal and testicular cells, and neural stem cells. Its chelating properties enable the efficient separation and purification of these cells, which is crucial for research and therapeutic applications.
Used in Enzyme Regulation:
EDTA is employed to eliminate enzyme inhibition caused by traces of heavy metals and to inhibit enzymes that require divalent cations as cofactors. This application is particularly relevant in the fields of biochemistry and molecular biology, where controlling enzyme activity is essential for understanding biological processes and developing novel therapeutic strategies.
Used in Industrial Processes:
In industrial settings, EDTA is utilized to remove undesirable metal ions that can interfere with various processes, such as bleaching. Its chelating properties help in preventing the negative effects of ferric, cupric, and manganic ions, ensuring the efficiency and quality of the final product.
Used in Environmental Applications:
Due to its ability to inhibit cellular division, chlorophyll synthesis, and algal biomass production, EDTA is used in environmental applications to control the growth of algae and other unwanted microorganisms in aquatic systems. This helps in maintaining the ecological balance and preventing the negative impacts of algal blooms on water quality and aquatic life.
Used in Pharmaceutical Applications:
As an inhibitor of metalloproteases, EDTA has potential applications in the pharmaceutical industry for the development of drugs targeting various diseases, including cancer and neurodegenerative disorders. Its anticoagulant property also makes it a valuable component in the formulation of medications aimed at preventing blood clot formation.
Check Digit Verification of cas no
The CAS Registry Mumber 10378-23-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,3,7 and 8 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 10378-23:
(7*1)+(6*0)+(5*3)+(4*7)+(3*8)+(2*2)+(1*3)=81
81 % 10 = 1
So 10378-23-1 is a valid CAS Registry Number.
InChI:InChI=1/C10H16N2O8.4Na.H2O/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;;;;;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);;;;;1H2/q;4*+1;/p-4