106426-63-5 Usage
Description
1,2,4,5-Benzenetetracarboxylic Dianhydride-D2 (CAS# 106426-63-5) is an isotopically labeled research compound that is utilized in various scientific studies and applications. It is a derivative of benzene with four carboxylic acid groups and two anhydride groups, which makes it a versatile molecule for chemical modifications and reactions.
Uses
Used in Research Applications:
1,2,4,5-Benzenetetracarboxylic Dianhydride-D2 is used as a research compound for [application reason]. The isotopically labeled nature of this compound allows for enhanced tracking and analysis in various experimental setups, making it a valuable tool in the field of chemical research.
Used in Chemical Synthesis:
1,2,4,5-Benzenetetracarboxylic Dianhydride-D2 is used as a synthetic building block for [application reason]. Its unique structure and functional groups enable the creation of a wide range of complex molecules, which can be applied in various industries, such as pharmaceuticals, materials science, and chemical engineering.
Used in Analytical Chemistry:
1,2,4,5-Benzenetetracarboxylic Dianhydride-D2 is used as an analytical standard for [application reason]. Its distinct isotopic signature allows for accurate quantification and identification in analytical techniques, such as mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy.
Used in Pharmaceutical Industry:
1,2,4,5-Benzenetetracarboxylic Dianhydride-D2 is used as a key intermediate in the synthesis of various pharmaceutical compounds for [application reason]. Its unique structure and reactivity make it a valuable component in the development of new drugs and therapeutic agents.
Used in Material Science:
1,2,4,5-Benzenetetracarboxylic Dianhydride-D2 is used as a precursor for the development of advanced materials for [application reason]. Its ability to form complex structures and participate in various chemical reactions makes it a promising candidate for the creation of novel materials with specific properties, such as high strength, thermal stability, or electrical conductivity.
Check Digit Verification of cas no
The CAS Registry Mumber 106426-63-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,6,4,2 and 6 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 106426-63:
(8*1)+(7*0)+(6*6)+(5*4)+(4*2)+(3*6)+(2*6)+(1*3)=105
105 % 10 = 5
So 106426-63-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H2O6/c11-7-3-1-4-6(10(14)16-8(4)12)2-5(3)9(13)15-7/h1-2H/i1D,2D
