107866-54-6 Usage
Description
1-ACETYL-1H-1,2,3-TRIAZOLO[4,5-B]PYRIDINE is an organic compound with a unique chemical structure that features a triazolopyridine ring and an acetyl group. It is known for its potential applications in various chemical and pharmaceutical processes due to its versatile reactivity and functional groups.
Uses
Used in Pharmaceutical Industry:
1-ACETYL-1H-1,2,3-TRIAZOLO[4,5-B]PYRIDINE is used as a reactant for the solid-phase synthesis of carpanone-based inhibitors of exocytosis from the Golgi apparatus. These inhibitors play a crucial role in regulating cellular processes and have potential therapeutic applications in treating various diseases.
1-ACETYL-1H-1,2,3-TRIAZOLO[4,5-B]PYRIDINE is also used as a reactant in the preparation of selective cyclooxygenase-2 (COX-2) inactivators. COX-2 inactivators are important in the development of anti-inflammatory and pain-relieving drugs, as they help reduce inflammation and pain without causing the side effects associated with traditional nonsteroidal anti-inflammatory drugs (NSAIDs).
Additionally, 1-ACETYL-1H-1,2,3-TRIAZOLO[4,5-B]PYRIDINE is utilized in the acetylation of amines, a chemical process that can enhance the properties of amine compounds, such as their stability, reactivity, or solubility. This modification can be beneficial in the development of new drugs and pharmaceutical agents.
Used in Chemical Synthesis Industry:
1-ACETYL-1H-1,2,3-TRIAZOLO[4,5-B]PYRIDINE serves as a valuable building block in the synthesis of various complex organic molecules and compounds. Its unique structure and functional groups make it a versatile starting material for the development of new chemical entities with potential applications in various industries, including pharmaceuticals, materials science, and agrochemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 107866-54-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,7,8,6 and 6 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 107866-54:
(8*1)+(7*0)+(6*7)+(5*8)+(4*6)+(3*6)+(2*5)+(1*4)=146
146 % 10 = 6
So 107866-54-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H6N4O/c1-5(12)11-6-3-2-4-8-7(6)9-10-11/h2-4H,1H3
107866-54-6Relevant articles and documents
Applications of 1-Alkoxycarbonyl- and 1-Acyl-v-triazolopyridines as Acylating Reagents
Torrini, Ines,Zecchini, Giampiero Pagani,Agrosi, Francesco,Paradisi, Mario Paglialunga
, p. 1459 - 1463 (2007/10/02)
Selective N-protection of hydroxyamino esters has been readily achieved using 1-alkoxycarbonyl- or 1-acyl-v-triazolopyridines.The amide-type triazolides reacted with alcohols in the presence of DBU at room temperature to afford in high yields the corresponding esters.The different reactivity of 1- and 3-alkoxycarbonyl derivatives of the title bicyclic system toward primary amines has been further investigated.