108043-99-8 Usage
General Description
2,4,6-tri-O-galloylglucose is a chemical compound classified as a gallotannin, which is a type of polyphenol found in various plants, particularly in tannin-rich tissues such as fruits, nuts, and seeds. It is composed of three molecules of gallic acid joined to a glucose molecule, and is known for its strong antioxidant and anti-inflammatory properties. It has been studied for its potential health benefits, including its role in reducing oxidative stress, protecting against liver damage, and potentially inhibiting the growth of cancer cells. 2,4,6-tri-O-galloylglucose is also being investigated for its potential therapeutic effects on various health conditions, making it an area of interest in pharmacological and medical research.
Check Digit Verification of cas no
The CAS Registry Mumber 108043-99-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,8,0,4 and 3 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 108043-99:
(8*1)+(7*0)+(6*8)+(5*0)+(4*4)+(3*3)+(2*9)+(1*9)=108
108 % 10 = 8
So 108043-99-8 is a valid CAS Registry Number.
InChI:InChI=1/C27H24O18/c28-7-19(44-26(41)10-3-14(31)21(37)15(32)4-10)23(39)24(45-27(42)11-5-16(33)22(38)17(34)6-11)18(35)8-43-25(40)9-1-12(29)20(36)13(30)2-9/h1-7,18-19,23-24,29-39H,8H2/t18-,19+,23-,24-/m1/s1