108902-83-6 Usage
General Description
4-(4-Methylphenoxy)phenylhydrazine hydrochloride is a chemical compound with the molecular formula C13H16N2O·HCl. It is a hydrazine derivative that is commonly used as a reagent in chemical research. The compound is a yellow crystalline powder that is soluble in water and organic solvents. It is known for its ability to block the activity of specific enzymes in the body, making it useful in the development of pharmaceuticals for the treatment of various diseases. Additionally, it is also used in the synthesis of other organic compounds due to its versatile reactivity. Overall, 4-(4-Methylphenoxy)phenylhydrazine hydrochloride is a valuable chemical with various applications in research and industry.
Check Digit Verification of cas no
The CAS Registry Mumber 108902-83-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,8,9,0 and 2 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 108902-83:
(8*1)+(7*0)+(6*8)+(5*9)+(4*0)+(3*2)+(2*8)+(1*3)=126
126 % 10 = 6
So 108902-83-6 is a valid CAS Registry Number.
InChI:InChI=1/C13H14N2O.ClH/c1-10-2-6-12(7-3-10)16-13-8-4-11(15-14)5-9-13;/h2-9,15H,14H2,1H3;1H
