115102-47-1 Usage
General Description
5-Ethoxy-furan-2-carboxylic acid is a chemical compound with the molecular formula C8H8O4. It is a derivative of furan and contains an ethoxy group and a carboxylic acid functional group. 5-ETHOXY-FURAN-2-CARBOXYLIC ACID is commonly used in the synthesis of pharmaceuticals and as a building block in organic chemistry. It has a wide range of potential applications due to its reactivity and versatility in chemical reactions. Additionally, it has shown promise in medicinal chemistry research for its potential as a drug intermediate or active ingredient in the development of new treatments. Overall, 5-Ethoxy-furan-2-carboxylic acid has significant value in the fields of pharmaceuticals and organic chemistry due to its unique structure and potential for diverse applications.
Check Digit Verification of cas no
The CAS Registry Mumber 115102-47-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,5,1,0 and 2 respectively; the second part has 2 digits, 4 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 115102-47:
(8*1)+(7*1)+(6*5)+(5*1)+(4*0)+(3*2)+(2*4)+(1*7)=71
71 % 10 = 1
So 115102-47-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H8O4/c1-2-10-6-4-3-5(11-6)7(8)9/h3-4H,2H2,1H3,(H,8,9)/p-1