115388-32-4 Usage
Description
NAN-190 HYDROBROMIDE is an N-alkylpiperazine compound that features a (2-methoxyphenyl)piperazine structure with the amine hydrogen replaced by a 4-(2-phthalimido)butyl group. It is a pharmaceutical compound with potential applications in various fields.
Uses
Used in Pharmaceutical Industry:
NAN-190 HYDROBROMIDE is used as a research chemical for the development of medications targeting specific receptors in the central nervous system. Its unique structure allows it to interact with these receptors, potentially leading to the creation of new therapeutic agents for various conditions.
Used in Research Applications:
In the field of scientific research, NAN-190 HYDROBROMIDE serves as a valuable tool for studying the effects of N-alkylpiperazine compounds on biological systems. It can be used to investigate receptor binding, signal transduction pathways, and the overall impact on cellular function.
Used in Drug Development:
NAN-190 HYDROBROMIDE is utilized in the process of drug development to identify potential lead compounds with therapeutic properties. Its unique chemical structure makes it a candidate for further optimization and modification to enhance its efficacy and safety profile in treating specific diseases.
Biological Activity
5-HT 1A antagonist.
Check Digit Verification of cas no
The CAS Registry Mumber 115388-32-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,5,3,8 and 8 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 115388-32:
(8*1)+(7*1)+(6*5)+(5*3)+(4*8)+(3*8)+(2*3)+(1*2)=124
124 % 10 = 4
So 115388-32-4 is a valid CAS Registry Number.
InChI:InChI=1/C23H27N3O3/c1-29-21-11-5-4-10-20(21)25-16-14-24(15-17-25)12-6-7-13-26-22(27)18-8-2-3-9-19(18)23(26)28/h2-5,8-11H,6-7,12-17H2,1H3/p+1