115913-58-1 Usage
General Description
4-Methyl-1-naphthylmagnesium bromide is an organometallic compound consisting of a magnesium atom bonded to a 4-methyl-1-naphthyl group and a bromine atom. It is commonly used in organic synthesis as a Grignard reagent, which is a crucial tool for the formation of carbon-carbon bonds. 4-METHYL-1-NAPHTHYLMAGNESIUM BROMIDE is often utilized in the synthesis of various organic molecules, including pharmaceuticals and natural products. Additionally, it can participate in reactions such as nucleophilic addition to carbonyl compounds and transition metal-catalyzed cross-coupling reactions, making it a versatile and valuable chemical building block in the field of organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 115913-58-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,5,9,1 and 3 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 115913-58:
(8*1)+(7*1)+(6*5)+(5*9)+(4*1)+(3*3)+(2*5)+(1*8)=121
121 % 10 = 1
So 115913-58-1 is a valid CAS Registry Number.
InChI:InChI=1/C11H9.BrH.Mg/c1-9-5-4-7-10-6-2-3-8-11(9)10;;/h2-6,8H,1H3;1H;/q;;+1/p-1/rC11H9BrMg/c1-8-6-7-11(13-12)10-5-3-2-4-9(8)10/h2-7H,1H3
