1196-41-4 Usage
Description
2,6-Dibromopurine, also known as 2,6-Dibromo-9H-purine, is an organic compound that serves as a key reagent in the synthesis of nucleosides and the preparation and oxidation of purines. It is characterized by the presence of two bromine atoms at the 2nd and 6th positions of the purine ring, which allows for various chemical reactions and modifications.
Uses
Used in Pharmaceutical Industry:
2,6-Dibromopurine is used as a reagent for the synthesis of nucleosides, which are essential components of nucleic acids and have significant applications in the development of antiviral and anticancer drugs. Its ability to undergo cyclization, ring transformation, and substituent modification makes it a versatile compound in the synthesis of various nucleoside analogs.
Used in Organic Chemistry:
2,6-Dibromopurine is used as a reagent for the effective synthesis of 2-bromoand 2-chloro-2''-deoxyadenosines (I; R = Br, Cl), which are compounds of interest for potential antitumor chemotherapy. These analogs can be further modified and studied for their potential therapeutic effects against cancer.
Used in Enzyme Inhibition:
2,6-Dibromopurine functions as an inhibitor for membrane-bound 3'',5''-cyclic-AMP phosphodiesterase, an enzyme involved in the regulation of cellular processes such as signal transduction and gene expression. By inhibiting this enzyme, 2,6-Dibromopurine can potentially modulate cellular functions and be used in the study of enzyme activity and its role in various biological processes.
Check Digit Verification of cas no
The CAS Registry Mumber 1196-41-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,1,9 and 6 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 1196-41:
(6*1)+(5*1)+(4*9)+(3*6)+(2*4)+(1*1)=74
74 % 10 = 4
So 1196-41-4 is a valid CAS Registry Number.
InChI:InChI=1/C5H2Br2N4/c6-3-2-4(9-1-8-2)11-5(7)10-3/h1H,(H,8,9,10,11)
