121720-53-4 Usage
Description
(2-Bromo-5-hexyl-2,5-cyclohexadiene-1,4-diylidene)bis-cyanamide is an organic chemical compound with the molecular formula C16H22BrN4. It features a 2,5-cyclohexadiene-1,4-diylidene core, a hexyl group attached to the 5-carbon position, and two cyanamide groups. (2-Bromo-5-hexyl-2,5-cyclohexadiene-1,4-diylidene)bis-cyanamide is known for its unique structural and chemical properties, which contribute to its potential applications in various fields.
Uses
Used in Chemical Synthesis:
(2-Bromo-5-hexyl-2,5-cyclohexadiene-1,4-diylidene)bis-cyanamide is used as a precursor in the synthesis of complex organic molecules. Its reactivity and potential for selective functionalization make it a valuable component in creating advanced chemical structures.
Used in Pharmaceutical Applications:
In the pharmaceutical industry, (2-Bromo-5-hexyl-2,5-cyclohexadiene-1,4-diylidene)bis-cyanamide may be utilized for the development of new functional materials and pharmaceuticals. Its unique properties could contribute to the creation of innovative drug candidates or delivery systems.
Used in Materials Science:
(2-Bromo-5-hexyl-2,5-cyclohexadiene-1,4-diylidene)bis-cyanamide has potential applications in materials science, where its structural and chemical attributes could be employed to develop new materials with specialized properties for various uses.
Check Digit Verification of cas no
The CAS Registry Mumber 121720-53-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,1,7,2 and 0 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 121720-53:
(8*1)+(7*2)+(6*1)+(5*7)+(4*2)+(3*0)+(2*5)+(1*3)=84
84 % 10 = 4
So 121720-53-4 is a valid CAS Registry Number.
InChI:InChI=1/C14H15BrN4/c1-2-3-4-5-6-11-7-14(19-10-17)12(15)8-13(11)18-9-16/h7-8H,2-6H2,1H3
