122030-04-0 Usage
Description
2,4,6-Trifluorobenzotrifluoride, also known as α,α,α-trifluorotoluene, is a colorless to slightly yellow liquid with chemical properties that make it a valuable compound in various industrial applications. It is characterized by the presence of three fluorine atoms at the 2nd, 4th, and 6th positions on the benzene ring, which imparts unique reactivity and stability to the molecule.
Uses
Used in Organic Synthesis:
2,4,6-Trifluorobenzotrifluoride is used as an intermediate in organic syntheses for the production of various chemicals and pharmaceuticals. Its unique fluorinated structure allows for the creation of a wide range of compounds with diverse applications.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2,4,6-trifluorobenzotrifluoride is used as a building block for the synthesis of various drug molecules. The presence of fluorine atoms in the molecule can significantly influence the pharmacokinetic and pharmacodynamic properties of the resulting drugs, making them more potent and selective.
Used in Chemical Industry:
2,4,6-Trifluorobenzotrifluoride is also utilized in the chemical industry for the production of specialty chemicals, such as agrochemicals, dyes, and polymers. The fluorinated nature of the compound provides unique properties to these materials, enhancing their performance and durability.
Used in Material Science:
In the field of material science, 2,4,6-trifluorobenzotrifluoride is employed in the development of advanced materials with specific properties, such as high thermal stability, chemical resistance, and low refractive index. These materials find applications in various sectors, including aerospace, electronics, and coatings.
Check Digit Verification of cas no
The CAS Registry Mumber 122030-04-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,2,0,3 and 0 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 122030-04:
(8*1)+(7*2)+(6*2)+(5*0)+(4*3)+(3*0)+(2*0)+(1*4)=50
50 % 10 = 0
So 122030-04-0 is a valid CAS Registry Number.
InChI:InChI=1/C14H10F2O/c1-9-5-7-10(8-6-9)14(17)13-11(15)3-2-4-12(13)16/h2-8H,1H3
