126293-44-5 Usage
Description
(5Z)-5-[(2-bromophenyl)methylidene]-3-[(4-bromophenyl)methylideneamino]-2-phenyl-imidazol-4-one is a heterocyclic organic compound characterized by an imidazole ring and two phenyl rings, each containing bromine atoms. It has a molecular formula of C24H18Br2N4O and a molecular weight of 520.235 g/mol. (5Z)-5-[(2-bromophenyl)methylidene]-3-[(4-bromophenyl)methylideneamino ]-2-phenyl-imidazol-4-one's structure features a five-membered imidazole ring with a phenyl group and a bromophenyl group attached to it, along with a bromophenylmethylideneamino group at the third position of the imidazole ring. Its unique structure and potential biological activity make it a compound of interest for applications in medicinal chemistry and pharmacology.
Uses
Used in Pharmaceutical Industry:
(5Z)-5-[(2-bromophenyl)methylidene]-3-[(4-bromophenyl)methylideneamino]-2-phenyl-imidazol-4-one is used as a potential active pharmaceutical ingredient (API) for the development of new drugs due to its heterocyclic structure and potential biological activity. Its unique chemical composition may allow for the targeting of specific biological pathways or receptors, making it a promising candidate for the treatment of various diseases.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, (5Z)-5-[(2-bromophenyl)methylidene]-3-[(4-bromophenyl)methylideneamino]-2-phenyl-imidazol-4-one is used as a starting material or a building block for the synthesis of more complex molecules with potential therapeutic applications. Its structural features can be exploited to design and develop novel compounds with improved pharmacological properties, such as increased potency, selectivity, or bioavailability.
Used in Drug Delivery Systems:
(5Z)-5-[(2-bromophenyl)methylidene]-3-[(4-bromophenyl)methylideneamino]-2-phenyl-imidazol-4-one may also be utilized in the development of drug delivery systems, where its unique structure could be employed to enhance the solubility, stability, or targeted delivery of therapeutic agents. This could lead to improved efficacy and reduced side effects for patients undergoing treatment with drugs based on this compound.
Check Digit Verification of cas no
The CAS Registry Mumber 126293-44-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,6,2,9 and 3 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 126293-44:
(8*1)+(7*2)+(6*6)+(5*2)+(4*9)+(3*3)+(2*4)+(1*4)=125
125 % 10 = 5
So 126293-44-5 is a valid CAS Registry Number.
InChI:InChI=1/C23H15Br2N3O/c24-19-12-10-16(11-13-19)15-26-28-22(17-6-2-1-3-7-17)27-21(23(28)29)14-18-8-4-5-9-20(18)25/h1-15H/b21-14-,26-15+