126485-58-3 Usage
Description
3-(3-METHOXYPHENYL)BENZALDEHYDE, also known as 3''-Methoxybiphenyl-3-carboxaldehyde, is an organic compound that serves as a reagent in the synthesis of arylsilanes. It is characterized by the presence of a methoxy group attached to a biphenyl structure, which contributes to its unique chemical properties and reactivity.
Uses
Used in Chemical Synthesis:
3-(3-METHOXYPHENYL)BENZALDEHYDE is used as a reagent for the preparation of arylsilanes, which are important intermediates in various chemical reactions. The presence of the methoxy group on the biphenyl structure enhances the reactivity of the compound, making it a valuable component in the synthesis of arylsilanes.
Used in Cross-Coupling Reactions:
In the field of organic chemistry, 3-(3-METHOXYPHENYL)BENZALDEHYDE plays a crucial role in cross-coupling reactions. These reactions are widely used for the formation of carbon-carbon bonds, which are essential in the synthesis of complex organic molecules. The reactivity of 3-(3-METHOXYPHENYL)BENZALDEHYDE allows for efficient coupling with other organic compounds, facilitating the synthesis of a wide range of chemical products.
Used in Pharmaceutical Industry:
3-(3-METHOXYPHENYL)BENZALDEHYDE and its derivatives have potential applications in the pharmaceutical industry. The unique structure and reactivity of this compound make it a promising candidate for the development of new drugs and drug candidates. Its use in the synthesis of biologically active molecules can lead to the discovery of novel therapeutic agents with improved efficacy and selectivity.
Used in Material Science:
In the field of material science, 3-(3-METHOXYPHENYL)BENZALDEHYDE can be utilized in the development of new materials with specific properties. Its reactivity and structural features can be exploited to create materials with tailored characteristics, such as improved conductivity, stability, or optical properties. This can lead to the development of innovative materials for various applications, including electronics, sensors, and energy storage devices.
Check Digit Verification of cas no
The CAS Registry Mumber 126485-58-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,6,4,8 and 5 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 126485-58:
(8*1)+(7*2)+(6*6)+(5*4)+(4*8)+(3*5)+(2*5)+(1*8)=143
143 % 10 = 3
So 126485-58-3 is a valid CAS Registry Number.
InChI:InChI=1/C14H12O2/c1-16-14-7-3-6-13(9-14)12-5-2-4-11(8-12)10-15/h2-10H,1H3
126485-58-3Relevant articles and documents
Design, synthesis, and biological evaluation of novel dual FFA1 and PPARδ agonists possessing phenoxyacetic acid scaffold
Zhou, Zongtao,Cai, Zongyu,Zhang, Congzi,Yang, Benhui,Chen, Lianru,He, Yepu,Zhang, Luyong,Li, Zheng
, (2022/01/24)
The free fatty acid receptor 1 (FFA1/GPR40) and peroxisome proliferator-activated receptor δ (PPARδ) have been widely considered as promising targets for type 2 diabetes mellitus (T2DM) due to their respective roles in promoting insulin secretion and impr
Betti reaction enables efficient synthesis of 8-hydroxyquinoline inhibitors of 2-oxoglutarate oxygenases
Thinnes,Tumber,Yapp,Scozzafava,Yeh,Chan,Tran,Hsu,Tarhonskaya,Walport,Wilkins,Martinez,Müller,Pugh,Ratcliffe,Brennan,Kawamura,Schofield
supporting information, p. 15458 - 15461 (2015/10/20)
There is interest in developing potent, selective, and cell-permeable inhibitors of human ferrous iron and 2-oxoglutarate (2OG) oxygenases for use in functional and target validation studies. The 3-component Betti reaction enables efficient one-step C-7 functionalisation of modified 8-hydroxyquinolines (8HQs) to produce cell-active inhibitors of KDM4 histone demethylases and other 2OG oxygenases; the work exemplifies how a template-based metallo-enzyme inhibitor approach can be used to give biologically active compounds.
Pd-EDTA as an efficient catalyst for Suzuki-Miyaura reactions in water
Korolev, Dmitrii N.,Bumagin, Nikolay A.
, p. 5751 - 5754 (2007/10/03)
PdCl2-EDTA complex 1 is an efficient catalyst for the Suzuki-Miyaura reactions of aryl and heteroaryl halides with aryl(heteroaryl)boronic acids in water at 20-100°C. Aryl iodides and bromides undergo the cross-coupling with turnover numbers (T
