12798-51-5 Usage
General Description
TEUCRIN A is a natural product isolated from the plant Teucrium polium, and is classified as a diterpenoid. It possesses a unique chemical structure with various functional groups, including a lactone, a carboxylic acid, and several hydroxyl groups. TEUCRIN A has demonstrated anti-inflammatory and antitumor activities in several studies, making it a potential candidate for drug development. The compound has also shown promise in the treatment of diabetes and cardiovascular diseases due to its ability to modulate various cellular pathways and processes. Additionally, TEUCRIN A has been investigated for its potential neuroprotective effects, further expanding its potential therapeutic applications. Overall, TEUCRIN A represents an intriguing natural product with diverse biological activities and potential pharmaceutical relevance.
Check Digit Verification of cas no
The CAS Registry Mumber 12798-51-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,2,7,9 and 8 respectively; the second part has 2 digits, 5 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 12798-51:
(7*1)+(6*2)+(5*7)+(4*9)+(3*8)+(2*5)+(1*1)=125
125 % 10 = 5
So 12798-51-5 is a valid CAS Registry Number.
InChI:InChI=1/C19H20O6/c1-9-15(20)16-14-11(17(21)25-16)3-2-4-12(14)19(9)7-13(24-18(19)22)10-5-6-23-8-10/h5-6,8-9,12-13,15-16,20H,2-4,7H2,1H3/t9-,12+,13+,15+,16-,19-/m1/s1