130100-08-2 Usage
Chemical compound
A complex molecule with a unique structure.
Molecular structure
Contains oxirane and thiirane functional groups.
Heterocyclic compound
Has a benzimidazole core, which is commonly found in drugs with various therapeutic uses.
Pharmaceutical applications
Potential uses in the development of new drugs due to its unique structure and potential reactivity.
Oxirane and thiirane moieties
Suggest potential reactivity and functionality in biological systems.
Pharmacological properties
Further investigation may reveal potential benefits for drug development.
Medicinal chemistry
Structural features make it of interest for potential exploration in drug design and discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 130100-08-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,0,1,0 and 0 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 130100-08:
(8*1)+(7*3)+(6*0)+(5*1)+(4*0)+(3*0)+(2*0)+(1*8)=42
42 % 10 = 2
So 130100-08-2 is a valid CAS Registry Number.
InChI:InChI=1/C13H14N2O2S/c16-13-14(5-9-7-17-9)11-3-1-2-4-12(11)15(13)6-10-8-18-10/h1-4,9-10H,5-8H2
