13117-26-5 Usage
Description
4-O-alpha-D-galactopyranosyl-D-galactose is a complex carbohydrate molecule that belongs to the family of disaccharides. It is characterized by its off-white solid appearance and plays a crucial role in the P blood-group system, acting as specific ligands towards receptors of uropathogenic E. coli and the Shigella dysenteriae toxin.
Uses
1. Used in Medical Applications:
4-O-alpha-D-galactopyranosyl-D-galactose is used as a biological marker for identifying and understanding the P blood-group system. Its role as a specific ligand helps in the prevention and treatment of infections caused by uropathogenic E. coli and Shigella dysenteriae toxin.
2. Used in Research and Development:
4-O-alpha-D-galactopyranosyl-D-galactose is used as a research tool for studying the interactions between carbohydrates and bacterial receptors. This knowledge can be applied to develop new strategies for combating bacterial infections and understanding the underlying mechanisms of these interactions.
3. Used in Pharmaceutical Industry:
4-O-alpha-D-galactopyranosyl-D-galactose is used as a potential therapeutic agent for the development of new drugs targeting bacterial infections. Its unique properties as a ligand make it a valuable compound for designing novel drugs that can specifically target and neutralize harmful bacteria.
4. Used in Diagnostics:
4-O-alpha-D-galactopyranosyl-D-galactose can be used in the development of diagnostic tools and tests to identify the presence of uropathogenic E. coli and Shigella dysenteriae toxin in patients. This can aid in early detection and timely treatment of related infections.
5. Used in Food Industry:
4-O-alpha-D-galactopyranosyl-D-galactose, due to its complex carbohydrate structure, can be used in the development of new food products with enhanced nutritional properties or as additives to improve the texture and shelf life of existing products.
Check Digit Verification of cas no
The CAS Registry Mumber 13117-26-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,1,1 and 7 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 13117-26:
(7*1)+(6*3)+(5*1)+(4*1)+(3*7)+(2*2)+(1*6)=65
65 % 10 = 5
So 13117-26-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H22O11/c13-1-4(16)7(18)11(5(17)2-14)23-12-10(21)9(20)8(19)6(3-15)22-12/h1,4-12,14-21H,2-3H2/t4-,5+,6+,7+,8-,9-,10+,11-,12+/m0/s1
