13149-69-4 Usage
Description
6-[bis[bis(isopropyl)amino]acetate]-D-gluconic acid is a complex chemical compound that consists of D-gluconic acid and multiple isopropylamine groups. The molecule features a unique bis[bis(isopropyl)amino]acetate bond structure, with isopropylamine groups attached to the acetate groups. This intricate arrangement suggests potential applications in various fields due to its complex structure and possible reactivity.
Uses
Used in Pharmaceutical Industry:
6-[bis[bis(isopropyl)amino]acetate]-D-gluconic acid is used as a pharmaceutical compound for its potential reactivity and complex structure, which may contribute to the development of new drugs and therapies.
Used in Organic Synthesis:
In the field of organic synthesis, 6-[bis[bis(isopropyl)amino]acetate]-D-gluconic acid is utilized as a key intermediate or building block for the synthesis of other complex organic molecules, taking advantage of its unique structural features.
Used in Chemical Research:
6-[bis[bis(isopropyl)amino]acetate]-D-gluconic acid serves as a subject of chemical research to explore its properties, reactivity, and potential applications, further expanding the understanding of complex organic compounds and their uses.
Check Digit Verification of cas no
The CAS Registry Mumber 13149-69-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,1,4 and 9 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 13149-69:
(7*1)+(6*3)+(5*1)+(4*4)+(3*9)+(2*6)+(1*9)=94
94 % 10 = 4
So 13149-69-4 is a valid CAS Registry Number.
InChI:InChI=1/C20H40N2O8/c1-10(2)21(11(3)4)18(22(12(5)6)13(7)8)20(29)30-9-14(23)15(24)16(25)17(26)19(27)28/h10-18,23-26H,9H2,1-8H3,(H,27,28)