134759-22-1 Usage
Description
5(6)-(BIOTINAMIDOCAPROYLAMIDO) PENTYLTHI is a biotinylated fluorescent probe that is primarily used for measuring the concentration of avidin or streptavidin. It is a compound with a unique structure that allows it to bind specifically to avidin or streptavidin, making it a valuable tool in various research and diagnostic applications.
Uses
Used in Research and Diagnostic Applications:
5(6)-(BIOTINAMIDOCAPROYLAMIDO) PENTYLTHI is used as a biotinylated fluorescent probe for measuring the concentration of avidin or streptavidin. This application is crucial in research and diagnostic settings, as it allows for the accurate determination of these proteins' levels, which can be indicative of certain conditions or used in the study of their biological functions.
Used in Organic Synthesis:
5(6)-(BIOTINAMIDOCAPROYLAMIDO) PENTYLTHI is also used as a compound in organic synthesis. Its unique structure and biotinylation make it a valuable component in the development of new molecules and compounds with potential applications in various industries, including pharmaceuticals, materials science, and chemical research.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 5(6)-(BIOTINAMIDOCAPROYLAMIDO) PENTYLTHI is used as a key component in the development of drugs and therapies targeting avidin or streptavidin-related conditions. Its ability to bind specifically to these proteins makes it a promising candidate for the design of targeted drug delivery systems and the development of novel therapeutic agents.
Used in Biotechnology Industry:
In the biotechnology industry, 5(6)-(BIOTINAMIDOCAPROYLAMIDO) PENTYLTHI is used as a vital component in the development of biosensors and diagnostic tools. Its high specificity for avidin or streptavidin makes it an ideal candidate for the creation of sensitive and accurate detection systems for various applications, including medical diagnostics, environmental monitoring, and food safety testing.
Check Digit Verification of cas no
The CAS Registry Mumber 134759-22-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,4,7,5 and 9 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 134759-22:
(8*1)+(7*3)+(6*4)+(5*7)+(4*5)+(3*9)+(2*2)+(1*2)=141
141 % 10 = 1
So 134759-22-1 is a valid CAS Registry Number.
InChI:InChI=1/C42H50N6O8S2/c49-26-13-16-29-33(22-26)55-34-23-27(50)14-17-30(34)42(29)31-21-25(12-15-28(31)39(53)56-42)46-41(57)45-20-8-2-7-19-44-36(51)10-3-1-6-18-43-37(52)11-5-4-9-35-38-32(24-58-35)47-40(54)48-38/h12-17,21-23,32,35,38,49-50H,1-11,18-20,24H2,(H,43,52)(H,44,51)(H2,45,46,57)(H2,47,48,54)/t32-,35-,38-/m0/s1