134974-39-3 Usage
Chemical structure
1,2,3,4-Tetrabromo-7,8-dichlorodibenzo-p-dioxin is a compound with four bromine atoms and two chlorine atoms attached to a dibenzo-p-dioxin backbone.
Toxicity
This compound is highly toxic, with a high potential for causing harm to both the environment and human health.
Persistence
As a persistent organic pollutant (POP), it remains in the environment for a long time, leading to long-term exposure and potential harm.
Classification
It is classified as a carcinogen, meaning it has the potential to cause cancer in humans and animals.
Adverse effects
Exposure to this chemical has been linked to a range of negative health outcomes, including developmental and reproductive issues, immune system disorders, and hormone disruption.
Industrial byproduct
1,2,3,4-Tetrabromo-7,8-dichlorodibenzo-p-dioxin is produced as a byproduct of various industrial processes, such as waste incineration and the production of certain herbicides and pesticides.
Check Digit Verification of cas no
The CAS Registry Mumber 134974-39-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,4,9,7 and 4 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 134974-39:
(8*1)+(7*3)+(6*4)+(5*9)+(4*7)+(3*4)+(2*3)+(1*9)=153
153 % 10 = 3
So 134974-39-3 is a valid CAS Registry Number.
InChI:InChI=1/C12H2Br4Cl2O2/c13-7-8(14)10(16)12-11(9(7)15)19-5-1-3(17)4(18)2-6(5)20-12/h1-2H
