135991-95-6 Usage
Description
2,3,3A,4,5,6-HEXAHYDRO-8-CYCLOHEXYL-1H-PYRAZINO[3,2,1-J,K]CARBAZOLE MESYLATE is a complex organic compound with a unique molecular structure. It is characterized by its hexahydro and cyclohexyl groups, which contribute to its chemical properties and potential applications in various fields.
Uses
Used in Pharmaceutical Industry:
2,3,3A,4,5,6-HEXAHYDRO-8-CYCLOHEXYL-1H-PYRAZINO[3,2,1-J,K]CARBAZOLE MESYLATE is used as a pharmaceutical compound for its potential anti-cancer effects. It may be particularly effective in preventing and treating prostate cancer, as it is part of a pharmaceutical composition designed to target and combat this specific type of cancer.
Used in Chemical Research:
Due to its unique molecular structure, 2,3,3A,4,5,6-HEXAHYDRO-8-CYCLOHEXYL-1H-PYRAZINO[3,2,1-J,K]CARBAZOLE MESYLATE may also be used as a research compound in the field of chemical research. It can be employed to study various chemical reactions, interactions, and properties, contributing to the advancement of knowledge in organic chemistry and related disciplines.
Please note that the provided materials do not contain specific information about the uses of 2,3,3A,4,5,6-HEXAHYDRO-8-CYCLOHEXYL-1H-PYRAZINO[3,2,1-J,K]CARBAZOLE MESYLATE. The uses mentioned above are inferred based on the general knowledge of similar compounds and their applications.
Biological Activity
Novel antidepressant, a selective inhibitor of MAO-A.
Check Digit Verification of cas no
The CAS Registry Mumber 135991-95-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,5,9,9 and 1 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 135991-95:
(8*1)+(7*3)+(6*5)+(5*9)+(4*9)+(3*1)+(2*9)+(1*5)=166
166 % 10 = 6
So 135991-95-6 is a valid CAS Registry Number.
InChI:InChI=1/C20H26N2/c1-2-5-14(6-3-1)15-9-10-19-17(13-15)16-7-4-8-18-20(16)22(19)12-11-21-18/h9-10,13-14,18,21H,1-8,11-12H2/p+1/t18-/m1/s1