144252-16-4 Usage
General Description
5-Naphthalen-2-yl-1-phenyl-1H-pyrazole-3-carboxylic acid is a chemical compound with a complex structure that includes naphthalene, phenyl, and pyrazole rings. It is a carboxylic acid derivative with potential biological and pharmacological properties. 5-NAPHTHALEN-2-YL-1-PHENYL-1H-PYRAZOLE-3-CARBOXYLIC ACID has been studied for its potential use in drug development, especially in the field of medicinal chemistry and drug discovery. Its unique structure and functional groups make it an interesting target for further research and potential application in various areas of biotechnology and pharmaceuticals.
Check Digit Verification of cas no
The CAS Registry Mumber 144252-16-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,4,2,5 and 2 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 144252-16:
(8*1)+(7*4)+(6*4)+(5*2)+(4*5)+(3*2)+(2*1)+(1*6)=104
104 % 10 = 4
So 144252-16-4 is a valid CAS Registry Number.
InChI:InChI=1/C20H14N2O2/c23-20(24)18-13-19(22(21-18)17-8-2-1-3-9-17)16-11-10-14-6-4-5-7-15(14)12-16/h1-13H,(H,23,24)