153275-53-7 Usage
General Description
CHLOROACETYL-1,2,3,4-TETRAMETHYLBENZENE is a chemical compound that contains a chloroacetyl group and a tetramethylbenzene group. It is commonly used as an intermediate in the synthesis of various organic compounds, including pharmaceuticals, agrochemicals, and polymers. The chloroacetyl group makes the compound highly reactive, allowing it to participate in a wide range of chemical reactions. Additionally, the presence of the tetramethylbenzene group provides the compound with unique chemical and physical properties, making it useful in various industrial applications. However, it is important to handle and store CHLOROACETYL-1,2,3,4-TETRAMETHYLBENZENE with caution, as it can be hazardous if not properly managed.
Check Digit Verification of cas no
The CAS Registry Mumber 153275-53-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,3,2,7 and 5 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 153275-53:
(8*1)+(7*5)+(6*3)+(5*2)+(4*7)+(3*5)+(2*5)+(1*3)=127
127 % 10 = 7
So 153275-53-7 is a valid CAS Registry Number.
InChI:InChI=1/C12H15ClO/c1-7-5-11(12(14)6-13)10(4)9(3)8(7)2/h5H,6H2,1-4H3
