153936-26-6 Usage
Description
2-AMINOMETHYL-3-METHYLPYRIDINE is an organic compound with the molecular formula C6H8N2. It is a heterocyclic compound featuring a pyridine ring with an aminomethyl group at the 2nd position and a methyl group at the 3rd position. 2-AMINOMETHYL-3-METHYLPYRIDINE is known for its potential applications in various chemical and pharmaceutical processes due to its unique structure and reactivity.
Uses
Used in Organic Synthesis:
2-AMINOMETHYL-3-METHYLPYRIDINE is used as an organic synthesis intermediate for the production of various chemical compounds. Its unique structure allows it to be a versatile building block in the synthesis of complex organic molecules, contributing to the development of new materials and chemicals.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2-AMINOMETHYL-3-METHYLPYRIDINE is utilized as a pharmaceutical intermediate. It plays a crucial role in the development of new drugs and medicines, particularly in the synthesis of active pharmaceutical ingredients (APIs) that target specific biological pathways or receptors.
Used in Laboratory Research and Development:
2-AMINOMETHYL-3-METHYLPYRIDINE is also employed in laboratory research and development processes. It serves as a valuable compound for scientists and researchers to study its chemical properties, reactivity, and potential applications in various fields, including drug discovery and material science.
Used in Chemical Production Process:
Furthermore, 2-AMINOMETHYL-3-METHYLPYRIDINE is used in the chemical production process, where it is transformed into various chemical products through a series of chemical reactions. Its presence in the production process highlights its importance in the synthesis of a wide range of chemicals with diverse applications.
Synthesis
3-methyl-2-cyanopyridine (10 g, 84.6 mmol) was dissolved in ethanol (200 mL) at room temperature, Raney nickel (4 g) was added to the reaction substrate, And then stirred at room temperature under hydrogen in a hydrogen atmosphere overnight. To be completed, Filter solids, The organic solvent was removed by distillation under reduced pressure to give 3-methyl-2-aminomethylpyridine (9.7 g, yield 94%).
Check Digit Verification of cas no
The CAS Registry Mumber 153936-26-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,3,9,3 and 6 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 153936-26:
(8*1)+(7*5)+(6*3)+(5*9)+(4*3)+(3*6)+(2*2)+(1*6)=146
146 % 10 = 6
So 153936-26-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H10N2/c1-6-3-2-4-9-7(6)5-8/h2-4H,5,8H2,1H3/p+1
153936-26-6Relevant articles and documents
Preparation method of N- phenyl-2-aminopyrimidine compound and its application
-
Paragraph 0171; 0175; 0176; 0177, (2017/04/28)
The invention relates to a new N- phenyl-2-aminopyrimidine compound and a medicine composition containing the compound; the N- phenyl-2-aminopyrimidine compound is applied to treat related disease or symptoms of epidermal growth factor receptor (EGFR), such as treat or improve abnormal cell proliferative disease like cancer.
Disubstituted piperidines as potent orexin (hypocretin) receptor antagonists
Jiang, Rong,Song, Xinyi,Bali, Purva,Smith, Anthony,Bayona, Claudia Ruiz,Lin, Li,Cameron, Michael D.,McDonald, Patricia H.,Kenny, Paul J.,Kamenecka, Theodore M.
scheme or table, p. 3890 - 3894 (2012/07/13)
A series of orexin receptor antagonists was synthesized based on a substituted piperidine scaffold. Through traditional medicinal chemistry structure-activity relationships (SAR), installation of various groups at the 3-6-positions of the piperidine led to modest enhancement in receptor selectivity. Compounds were profiled in vivo for plasma and brain levels in order to identify candidates suitable for efficacy in a model of drug addiction.