157327-44-1 Usage
General Description
4,5,6,7-Tetrahydro-1H-pyrazolo[4,3-c]pyridine dihydrochloride is a complex organic compound that belongs to the class of organic compounds known as pyrazolopyridines, characterized by a pyrazolopyridine moiety, which is a bicyclic compound made up of a pyrazole ring and a pyridine ring fused together. The two hydrogen chloride molecules in the compound imply it is a salt and will likely have high water solubility. This chemical is not naturally occurring and is often synthesized in a laboratory setting. Its exact uses vary greatly depending on the specification of any additional functional groups, but the presence of both pyrazole and pyridine rings suggests it could potentially have applications in the field of medicinal chemistry as they are commonly found within pharmacologically active compounds. Overall, this organic compound is highly specific and specialized, indicating it is likely to be used in advanced scientific research.
Check Digit Verification of cas no
The CAS Registry Mumber 157327-44-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,7,3,2 and 7 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 157327-44:
(8*1)+(7*5)+(6*7)+(5*3)+(4*2)+(3*7)+(2*4)+(1*4)=141
141 % 10 = 1
So 157327-44-1 is a valid CAS Registry Number.
InChI:InChI=1/C6H9N3.2ClH/c1-2-7-3-5-4-8-9-6(1)5;;/h4,7H,1-3H2,(H,8,9);2*1H
