158654-75-2 Usage
Description
Isoquinoline, 7-(bromomethyl)(9CI) is an organic compound belonging to the isoquinoline family, characterized by the presence of a bromomethyl group at the 7th position. This structural feature endows it with unique chemical properties and reactivity, making it a versatile building block in organic synthesis and a potential candidate for various applications in the pharmaceutical and chemical industries.
Uses
Used in Pharmaceutical Industry:
Isoquinoline, 7-(bromomethyl)(9CI) is used as a synthetic intermediate for the preparation of benzimidazole derivatives, which are known as TRPC6 inhibitors. TRPC6 (Transient Receptor Potential Canonical 6) is a calcium-permeable cation channel involved in various physiological processes, and its inhibition can be therapeutically beneficial in treating conditions such as chronic pain, hypertension, and certain types of cancer. By serving as a key intermediate in the synthesis of these inhibitors, Isoquinoline, 7-(bromomethyl)(9CI) plays a crucial role in the development of novel therapeutic agents targeting TRPC6.
Used in Chemical Industry:
Isoquinoline, 7-(bromomethyl)(9CI) can also be utilized as a building block in the synthesis of various organic compounds, such as pharmaceuticals, agrochemicals, and other specialty chemicals. Its unique structural features, including the bromomethyl group, allow for further functionalization and modification, enabling the creation of a diverse range of molecules with tailored properties and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 158654-75-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,8,6,5 and 4 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 158654-75:
(8*1)+(7*5)+(6*8)+(5*6)+(4*5)+(3*4)+(2*7)+(1*5)=172
172 % 10 = 2
So 158654-75-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H8BrN/c11-6-8-1-2-9-3-4-12-7-10(9)5-8/h1-5,7H,6H2
