159790-78-0 Usage
Description
1-BENZYL-5-NITROIMIDAZOLE, also known as 5-Nitro-1-(phenylmethyl)-1H-imidazole, is an organic compound that serves as a crucial intermediate in the synthesis of nitroimidazole-based compounds. It is characterized by its imidazole ring structure with a nitro group at the 5th position and a benzyl group attached to the 1st position. This unique molecular structure endows it with specific chemical properties and reactivity, making it a valuable component in the development of various pharmaceutical and chemical products.
Uses
Used in Pharmaceutical Industry:
1-BENZYL-5-NITROIMIDAZOLE is used as a key intermediate in the synthesis of nitroimidazole-based compounds for various pharmaceutical applications. Its role in the development of these compounds is crucial, as it contributes to the overall structure and function of the final product. Nitroimidazole-based compounds have been found to possess a range of biological activities, including antimicrobial, antifungal, and anticancer properties, making them valuable in the treatment of various diseases and conditions.
Used in Antimicrobial Applications:
In the field of antimicrobial research, 1-BENZYL-5-NITROIMIDAZOLE is utilized as a starting material for the development of new nitroimidazole-based antimicrobial agents. These agents are effective against a wide range of bacterial and fungal infections, offering potential alternatives to conventional antibiotics and antifungals. The unique properties of nitroimidazole-based compounds allow them to target specific cellular processes in pathogens, leading to their growth inhibition or destruction.
Used in Anticancer Applications:
1-BENZYL-5-NITROIMIDAZOLE also plays a significant role in the development of nitroimidazole-based anticancer drugs. These compounds have been shown to exhibit cytotoxic effects on various types of cancer cells, making them promising candidates for cancer therapy. The synthesis of these compounds involves the use of 1-BENZYL-5-NITROIMIDAZOLE as a key intermediate, allowing researchers to explore and optimize their chemical structures for enhanced anticancer activity.
Used in Chemical Research:
In addition to its applications in the pharmaceutical industry, 1-BENZYL-5-NITROIMIDAZOLE is also used as a valuable research tool in various fields of chemistry. Its unique chemical properties and reactivity make it an attractive candidate for the synthesis of novel compounds with potential applications in materials science, catalysis, and other areas of chemical research. By understanding the reactivity and behavior of 1-BENZYL-5-NITROIMIDAZOLE, chemists can design and develop new synthetic routes and strategies for the creation of innovative chemical products.
Check Digit Verification of cas no
The CAS Registry Mumber 159790-78-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,9,7,9 and 0 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 159790-78:
(8*1)+(7*5)+(6*9)+(5*7)+(4*9)+(3*0)+(2*7)+(1*8)=190
190 % 10 = 0
So 159790-78-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H9N3O2/c14-13(15)10-6-11-8-12(10)7-9-4-2-1-3-5-9/h1-6,8H,7H2
159790-78-0Relevant articles and documents
Vicarious nucleophilic substitution of 1-benzyl-5-nitroimidazole, application to the synthesis of 6,7-dihydroimidazo[4,5-d][1,3]diazepin-8(3H)-one
Chen, Bang-Chi,Chao, Sam T.,Sundeen, Joseph E.,Tellew, John,Ahmad, Saleem
, p. 1595 - 1596 (2002)
Reaction of 1-benzyl-5-nitroimidazole with carbanion generated from chloroform and potassium tert-butoxide afforded 1-benzyl-4-dichloromethyl-5-nitroimidazole in 72% yield. This vicarious nucleophilic substitution reaction was successfully applied to the synthesis of 6,7-dihydroimidazo[4,5-d][1,3]diazepin-8(3H)-one, an important intermediate in the synthesis of natural and biologically active compounds.
