16015-48-8 Usage
Description
3-Ethyl-4-oxo-3,4-dihydro-phthalazine-1-carboxylic acid is a chemical compound with the molecular formula C11H11NO3. It is a derivative of phthalazine, containing an ethyl group and a carboxylic acid substituent. 3-ETHYL-4-OXO-3,4-DIHYDRO-PHTHALAZINE-1-CARBOXYLIC ACID has potential applications in pharmaceutical research and drug development due to its structural features and potential biological activities.
Uses
Used in Pharmaceutical Research and Drug Development:
3-Ethyl-4-oxo-3,4-dihydro-phthalazine-1-carboxylic acid is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique structure and potential biological activities make it a promising candidate for the development of new drugs.
Used in Anti-Inflammatory Applications:
3-Ethyl-4-oxo-3,4-dihydro-phthalazine-1-carboxylic acid is used as an anti-inflammatory agent, potentially providing relief from inflammation and associated symptoms. Its anti-inflammatory properties may be attributed to its ability to modulate inflammatory pathways and reduce the production of pro-inflammatory mediators.
Used in Antifungal Applications:
3-Ethyl-4-oxo-3,4-dihydro-phthalazine-1-carboxylic acid is used as an antifungal agent, exhibiting activity against various fungal species. Its antifungal properties may be due to its ability to disrupt fungal cell membrane integrity and inhibit essential fungal enzymes.
Used in Antibacterial Applications:
3-Ethyl-4-oxo-3,4-dihydro-phthalazine-1-carboxylic acid is used as an antibacterial agent, showing activity against a range of bacterial pathogens. Its antibacterial properties may be attributed to its ability to interfere with bacterial cell wall synthesis and inhibit bacterial protein synthesis.
Used in Antitumor Applications:
3-Ethyl-4-oxo-3,4-dihydro-phthalazine-1-carboxylic acid is used as an antitumor agent, potentially exhibiting anticancer properties. Its antitumor activity may be due to its ability to induce apoptosis in cancer cells, inhibit cancer cell proliferation, and modulate signaling pathways involved in tumor growth and progression.
Further research is needed to fully understand the chemical and biological properties of 3-ethyl-4-oxo-3,4-dihydro-phthalazine-1-carboxylic acid and to explore its potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 16015-48-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,0,1 and 5 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 16015-48:
(7*1)+(6*6)+(5*0)+(4*1)+(3*5)+(2*4)+(1*8)=78
78 % 10 = 8
So 16015-48-8 is a valid CAS Registry Number.
InChI:InChI=1/C11H10N2O3/c1-2-13-10(14)8-6-4-3-5-7(8)9(12-13)11(15)16/h3-6H,2H2,1H3,(H,15,16)