16088-19-0 Usage
Description
3-Dimethylaminophenyl dimethylcarbamate is an organic compound with the chemical structure featuring a dimethylamino group attached to a phenyl ring, which is further connected to a dimethylcarbamate group. It is a derivative of carbamic acid and is known for its specific chemical properties and potential applications in various industries.
Uses
Used in Pharmaceutical Industry:
3-Dimethylaminophenyl dimethylcarbamate is used as an intermediate in the synthesis of various pharmaceutical compounds, particularly those with potential neuromuscular blocking or stimulant properties. Its unique chemical structure allows it to be a versatile building block for the development of new drugs.
Used in Chemical Synthesis:
In the field of organic chemistry, 3-dimethylaminophenyl dimethylcarbamate serves as a key intermediate for the production of other complex organic molecules. Its reactivity and functional groups make it a valuable component in the synthesis of various chemical products, including agrochemicals, dyes, and specialty chemicals.
Used in Research and Development:
3-Dimethylaminophenyl dimethylcarbamate is also utilized in research and development settings, where it can be employed to study the effects of specific chemical modifications on the properties and activities of related compounds. Its use in this context aids in the advancement of scientific knowledge and the discovery of new applications for this class of compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 16088-19-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,0,8 and 8 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 16088-19:
(7*1)+(6*6)+(5*0)+(4*8)+(3*8)+(2*1)+(1*9)=110
110 % 10 = 0
So 16088-19-0 is a valid CAS Registry Number.
InChI:InChI=1/C11H16N2O2/c1-12(2)9-6-5-7-10(8-9)15-11(14)13(3)4/h5-8H,1-4H3
