161532-56-5 Usage
Description
Posaconazole inter-8, also known as Deshydroxypentanyl Posaconazole, is an intermediate compound derived from 4-[4-(4-Methyloxyphenyl)-piperazin-1-yl]-phenyl-2,4-dihydro-[1,2,4]-triazol-3-one (M266245). It plays a crucial role in the synthesis of Itraconazole (I937500), a well-known antifungal agent. Posaconazole inter-8 is characterized by its ability to contribute to the development of effective antifungal medications.
Uses
Used in Pharmaceutical Industry:
Posaconazole inter-8 is used as a key intermediate in the synthesis of Itraconazole, an antifungal agent, for the treatment of various fungal infections. Its role in the production process is essential, as it helps in the development of medications that combat a wide range of fungal pathogens, providing relief and improved health outcomes for patients suffering from such infections.
Used in Antifungal Research:
Posaconazole inter-8 serves as a valuable compound in the field of antifungal research, where it is utilized to study the properties and mechanisms of action of antifungal agents. This research can lead to the discovery of new antifungal drugs or the improvement of existing ones, ultimately contributing to the advancement of medical treatments for fungal infections.
Used in Drug Development:
In the drug development industry, Posaconazole inter-8 is employed as a starting material for the creation of new antifungal medications. Its unique chemical properties make it an attractive candidate for further modification and optimization, potentially leading to the development of more effective and targeted antifungal therapies.
Check Digit Verification of cas no
The CAS Registry Mumber 161532-56-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,6,1,5,3 and 2 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 161532-56:
(8*1)+(7*6)+(6*1)+(5*5)+(4*3)+(3*2)+(2*5)+(1*6)=115
115 % 10 = 5
So 161532-56-5 is a valid CAS Registry Number.
InChI:InChI=1/C32H32F2N8O3/c33-24-1-10-29(30(34)15-24)32(19-41-21-35-20-37-41)16-23(18-45-32)17-44-28-8-6-26(7-9-28)40-13-11-39(12-14-40)25-2-4-27(5-3-25)42-22-36-38-31(42)43/h1-10,15,20-23H,11-14,16-19H2,(H,38,43)/t23-,32+/m1/s1