163517-62-2 Usage
Description
5-Fluoro-2-methylphenylboronic acid is an organic compound that serves as a versatile intermediate in the field of organic synthesis. It is a white solid with unique chemical properties that make it valuable for various applications in different industries.
Uses
Used in Organic Synthesis:
5-Fluoro-2-methylphenylboronic acid is used as a key intermediate for organic synthesis, particularly in the development of pharmaceuticals, agrochemicals, and other specialty chemicals. Its unique structure allows for the creation of a wide range of complex molecules with diverse applications.
Used in Monoarylation of Dibromoarenes:
In the chemical industry, 5-Fluoro-2-methylphenylboronic acid is used as a reactant for the monoarylation of dibromoarenes, which is catalyzed by palladium-phosphine in the presence of potassium carbonate. This process is essential for the synthesis of various organic compounds with specific functional groups.
Used in the Preparation of Homoleptic Diarylmercurials:
5-Fluoro-2-methylphenylboronic acid is also utilized in the preparation of homoleptic diarylmercurials, which are compounds containing mercury and two aryl groups. These compounds have potential applications in various fields, including materials science and catalysis.
Used in Suzuki-Miyaura Coupling:
5-Fluoro-2-methylphenylboronic acid plays a crucial role in the Suzuki-Miyaura coupling reaction, a widely used method for the formation of carbon-carbon bonds in organic chemistry. This reaction is particularly important in the synthesis of complex organic molecules, such as pharmaceuticals and natural products.
Used in the Suzuki Reaction:
The Suzuki reaction, a cross-coupling reaction between an organoboron compound and an organic halide, is another application of 5-Fluoro-2-methylphenylboronic acid. This reaction is widely used in the synthesis of various organic compounds, including those with potential applications in the pharmaceutical, agrochemical, and materials science industries.
Check Digit Verification of cas no
The CAS Registry Mumber 163517-62-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,6,3,5,1 and 7 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 163517-62:
(8*1)+(7*6)+(6*3)+(5*5)+(4*1)+(3*7)+(2*6)+(1*2)=132
132 % 10 = 2
So 163517-62-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H8BFO2/c1-5-2-3-6(9)4-7(5)8(10)11/h2-4,10-11H,1H3
