164149-28-4 Usage
Description
4-Cyano-2-fluorobenzoic acid is an organic compound characterized by its off-white powder form. It is a significant raw material and intermediate utilized in various chemical processes, particularly in the synthesis of organic compounds, pharmaceuticals, agrochemicals, and dyes.
Uses
Used in Organic Synthesis:
4-Cyano-2-fluorobenzoic acid is used as a key intermediate in organic synthesis for the production of various chemical compounds. Its unique structure allows for versatile reactions and the formation of a wide range of derivatives, making it valuable in the development of new organic molecules.
Used in Pharmaceutical Industry:
In the pharmaceutical sector, 4-Cyano-2-fluorobenzoic acid is employed as a building block for the synthesis of drug molecules. Its presence in the molecular structure can impart specific therapeutic properties, contributing to the development of novel medications with improved efficacy and safety profiles.
Used in Agrochemicals:
4-Cyano-2-fluorobenzoic acid is utilized as an intermediate in the production of agrochemicals, such as pesticides and herbicides. Its incorporation into these compounds can enhance their effectiveness in controlling pests and weeds, thereby supporting agricultural productivity and crop protection.
Used in Dye Industry:
In the dye industry, 4-Cyano-2-fluorobenzoic acid is used as a precursor for the synthesis of various dyes and pigments. Its chemical properties enable the creation of a diverse palette of colors, which can be applied across different industries, including textiles, plastics, and printing inks.
Check Digit Verification of cas no
The CAS Registry Mumber 164149-28-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,6,4,1,4 and 9 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 164149-28:
(8*1)+(7*6)+(6*4)+(5*1)+(4*4)+(3*9)+(2*2)+(1*8)=134
134 % 10 = 4
So 164149-28-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H9FO2/c10-8-4-2-1-3-7(8)5-6-9(11)12/h1-4H,5-6H2,(H,11,12)
164149-28-4Relevant articles and documents
N-acylamino acid amide compounds and intermediates for preparation thereof
-
, (2008/06/13)
The present invention discloses the compound represented by the formula (I): wherein A represents the following formula (a-1) or the following formula (a-2): B represents the following formula (b): (wherein the symbols are each as defined in the specification) or a pharmaceutically acceptable salts thereof, and intermediates for the preparation thereof, which have excellent platelet aggregation inhibitory activity and other properties and useful as prophylactic or therapeutic agents for diseases associated with a fibrinogen receptor, thrombosis, infarction and the like.
