16825-54-0 Usage
Description
1,3-Benzenediol,4-pentadecyl-, also known as 4-Pentadecylresorcinol, is a long-chain phenol derived from Ginkgo biloba, a plant known for its medicinal properties. It possesses a unique chemical structure with a resorcinol core and a long aliphatic chain, which contributes to its various biological activities and potential applications in the pharmaceutical and chemical industries.
Uses
Used in Pharmaceutical Industry:
1,3-Benzenediol,4-pentadecylis used as a reagent for the synthesis of antitumor agents. It is particularly effective in the development of long-chain phenols with potent antitumor activity, as demonstrated through the application of the Hansch-Fujita equation. This equation is a quantitative structure-activity relationship (QSAR) model that helps predict the biological activity of compounds based on their molecular structure.
The antitumor activity of 1,3-Benzenediol,4-pentadecylis attributed to its ability to interfere with essential cellular processes in cancer cells, leading to the inhibition of tumor growth and proliferation. Its unique structure allows it to target specific molecular pathways and proteins involved in cancer progression, making it a promising candidate for the development of novel cancer therapeutics.
In addition to its antitumor properties, 1,3-Benzenediol,4-pentadecylmay also have potential applications in other areas of the pharmaceutical industry, such as in the development of drugs targeting inflammation, oxidative stress, and other diseases where the modulation of cellular processes is crucial.
Used in Chemical Industry:
1,3-Benzenediol,4-pentadecylcan also be utilized in the chemical industry for various purposes, such as a starting material for the synthesis of other bioactive compounds, additives, or intermediates in the production of specialty chemicals. Its unique structure and properties make it a valuable component in the development of new materials and products with specific applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 16825-54-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,8,2 and 5 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 16825-54:
(7*1)+(6*6)+(5*8)+(4*2)+(3*5)+(2*5)+(1*4)=120
120 % 10 = 0
So 16825-54-0 is a valid CAS Registry Number.
InChI:InChI=1/C21H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19-16-17-20(22)18-21(19)23/h16-18,22-23H,2-15H2,1H3
