1688-85-3 Usage
Description
2-amino-7-methyl-3,9-dihydropurine-6,8-dione, also known as 7-methylguanine, is an oxopurine derivative of guanine with an oxo group at position 8 and a methyl substituent at position 7. It is a naturally occurring compound found in DNA and RNA, playing a crucial role in various biological processes.
Uses
Used in Pharmaceutical Industry:
2-amino-7-methyl-3,9-dihydropurine-6,8-dione is used as an active pharmaceutical ingredient for the development of antiviral and anticancer drugs. Its unique structure allows it to interfere with the replication and transcription processes of viruses and cancer cells, leading to their inhibition and eventual death.
Used in Research and Development:
2-amino-7-methyl-3,9-dihydropurine-6,8-dione is utilized as a research compound in the study of nucleic acid structure, function, and interactions. It serves as a valuable tool for understanding the mechanisms of DNA and RNA synthesis, repair, and regulation, as well as the development of novel therapeutic agents targeting these processes.
Used in Diagnostic Applications:
2-amino-7-methyl-3,9-dihydropurine-6,8-dione can be employed as a diagnostic marker for various diseases, including cancer and viral infections. Its presence or modification in biological samples can provide valuable information about the disease progression and response to treatment, aiding in early detection and personalized medicine approaches.
Check Digit Verification of cas no
The CAS Registry Mumber 1688-85-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,6,8 and 8 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 1688-85:
(6*1)+(5*6)+(4*8)+(3*8)+(2*8)+(1*5)=113
113 % 10 = 3
So 1688-85-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H7N5O2/c1-11-2-3(9-6(11)13)8-5(7)10-4(2)12/h1H3,(H4,7,8,9,10,12,13)
