171058-18-7 Usage
Description
1-Decyl-3-methylimidazolium chloride is a surface-active ionic liquid, characterized by its clear orange viscous oil appearance. It is synthesized by reacting 1-methylimidazole with 1-chlorodecane, resulting in a compound with unique properties that make it suitable for various applications.
Uses
Used in Chemical Synthesis:
1-Decyl-3-methylimidazolium chloride is used as a precursor in the preparation of other ionic compounds, such as 1-decyl-3-methylimidazolium triflate. This is achieved through a reaction with sodium triflate, showcasing its utility in the synthesis of novel ionic materials for various applications.
Used in Surface Activity Applications:
As a surface-active ionic liquid, 1-decyl-3-methylimidazolium chloride is utilized in applications that require properties such as solubility, wettability, and the ability to form micelles. Its amphiphilic nature allows it to be used in processes like emulsification, extraction, and the formulation of various products in different industries.
Used in Green Chemistry:
1-Decyl-3-methylimidazolium chloride is also employed in green chemistry practices, where it serves as an environmentally friendly alternative to traditional solvents. Its ability to improve reaction rates, selectivity, and reduce waste makes it a valuable component in sustainable chemical processes.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 1-decyl-3-methylimidazolium chloride is used as a component in drug delivery systems, enhancing the solubility and bioavailability of various drugs. Its unique properties also make it suitable for use in the development of new pharmaceutical formulations and drug delivery technologies.
Used in Material Science:
1-Decyl-3-methylimidazolium chloride is utilized in material science for the development of new materials with specific properties. Its ability to form self-assembled structures and interact with various substrates makes it a promising candidate for applications in nanotechnology, sensors, and other advanced material systems.
Conductivity
0.02 mS/cm (30 °C)
Check Digit Verification of cas no
The CAS Registry Mumber 171058-18-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,1,0,5 and 8 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 171058-18:
(8*1)+(7*7)+(6*1)+(5*0)+(4*5)+(3*8)+(2*1)+(1*8)=117
117 % 10 = 7
So 171058-18-7 is a valid CAS Registry Number.
InChI:InChI=1/C14H28N2.ClH/c1-3-4-5-6-7-8-9-10-11-16-13-12-15(2)14-16;/h12-13H,3-11,14H2,1-2H3;1H
