173838-63-6 Usage
Description
4-[4-(3-Pyridyl)imidazol-1-yl]butylamine is a heterocyclic compound characterized by its unique chemical structure, which features a combination of imidazole and pyridine rings. This structure endows the compound with specific properties that make it valuable in various applications, particularly in the pharmaceutical industry.
Uses
Used in Pharmaceutical Industry:
4-[4-(3-Pyridyl)imidazol-1-yl]butylamine is used as a heterocyclic reagent for the preparation of pharmaceuticals. Its unique chemical structure allows it to be a key component in the synthesis of various drugs, contributing to their overall effectiveness and therapeutic properties.
Used in the Synthesis of Macrolides:
In the field of antibiotic development, 4-[4-(3-Pyridyl)imidazol-1-yl]butylamine is used in the synthesis of macrolide compounds, such as desmethyl Telithromycin (T016500). This ketolide antibiotic is specifically designed to treat respiratory infections, providing a targeted approach to combat bacterial infections in the respiratory system.
By understanding the description and uses of 4-[4-(3-Pyridyl)imidazol-1-yl]butylamine, we can appreciate its significance in the pharmaceutical industry and its potential impact on the development of new drugs and treatments for various medical conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 173838-63-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,3,8,3 and 8 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 173838-63:
(8*1)+(7*7)+(6*3)+(5*8)+(4*3)+(3*8)+(2*6)+(1*3)=166
166 % 10 = 6
So 173838-63-6 is a valid CAS Registry Number.
InChI:InChI=1/C12H16N4/c13-5-1-2-7-16-9-12(15-10-16)11-4-3-6-14-8-11/h3-4,6,8-10H,1-2,5,7,13H2
