175202-83-2 Usage
Derivative of hydrazine
The compound is derived from hydrazine, which is a simple organic compound with the molecular formula N2H4, indicating a relationship between the structure and properties of the two compounds.
Imidazole ring
The compound contains an imidazole ring, which is a five-membered heterocyclic aromatic ring system consisting of three carbon atoms and two nitrogen atoms.
Two bromine atoms and two chlorine atoms attached
The imidazole ring in the compound has two bromine atoms and two chlorine atoms as substituents, which can influence the compound's reactivity, polarity, and lipophilicity.
Building block in synthesis of pharmaceuticals and agrochemicals
The compound serves as an intermediate in the synthesis of various pharmaceuticals and agrochemicals, meaning it can be used to create more complex molecules with desired biological activities.
Potential applications in drug development
2-(2-Bromo-4,5-dichloro-1H-imidazol-1-yl)ethanohydrazide has potential applications in the development of drugs for the treatment of various diseases, indicating its importance in medicinal chemistry.
Manufacturing of pesticides
The compound can also be used in the manufacturing of pesticides, which are chemicals designed to prevent, control, or kill pests that may be harmful to crops or humans.
Reagent in chemical research and organic synthesis
As a reagent, the compound can be used in various chemical reactions and processes to facilitate the formation of new bonds or the transformation of other chemical species, contributing to the advancement of chemical knowledge and the development of new materials.
Check Digit Verification of cas no
The CAS Registry Mumber 175202-83-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,0 and 2 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 175202-83:
(8*1)+(7*7)+(6*5)+(5*2)+(4*0)+(3*2)+(2*8)+(1*3)=122
122 % 10 = 2
So 175202-83-2 is a valid CAS Registry Number.
InChI:InChI=1/C5H5BrCl2N4O/c6-5-10-3(7)4(8)12(5)1-2(13)11-9/h1,9H2,(H,11,13)
