175276-86-5 Usage
General Description
ETHYL 2-(2,3-DICHLOROPHENYL)-1,3-THIAZOLE-4-CARBOXYLATE is a chemical compound with the molecular formula C12H9Cl2NO2S. It is a thiazole derivative that contains an ethyl ester group, a carboxylic acid group, and two chlorine atoms attached to a phenyl ring. ETHYL 2-(2,3-DICHLOROPHENYL)-1,3-THIAZOLE-4-CARBOXYLATE has potential applications in the fields of pharmaceuticals, agrochemicals, and materials science due to its diverse pharmacological and biological activities. It is also used as an intermediate in the synthesis of various organic compounds and can serve as a building block for the development of new chemical entities. The unique structure and properties of ETHYL 2-(2,3-DICHLOROPHENYL)-1,3-THIAZOLE-4-CARBOXYLATE make it a valuable and versatile compound in the chemical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 175276-86-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,7 and 6 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 175276-86:
(8*1)+(7*7)+(6*5)+(5*2)+(4*7)+(3*6)+(2*8)+(1*6)=165
165 % 10 = 5
So 175276-86-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H9Cl2NO2S/c1-2-17-12(16)9-6-18-11(15-9)7-4-3-5-8(13)10(7)14/h3-6H,2H2,1H3
