17598-15-1 Usage
Description
(2-Hydroxyethyl)ammonium hydrogen tartrate, also known as trometamol salt of tartaric acid, is a chemical compound with the molecular formula C6H11NO6. It is a white crystalline powder that is commonly used as a buffer and pH regulator in pharmaceutical and cosmetic products. As a salt of tartaric acid, it has a variety of functional properties including the ability to act as an emulsifier, chelating agent, and stabilizer.
Uses
Used in Pharmaceutical Industry:
(2-Hydroxyethyl)ammonium hydrogen tartrate is used as a buffer and pH regulator for maintaining the desired pH levels in various pharmaceutical formulations. Its buffering capacity helps to stabilize the pH of medications, ensuring their efficacy and safety.
Used in Cosmetic Industry:
(2-Hydroxyethyl)ammonium hydrogen tartrate is used as an emulsifier, chelating agent, and stabilizer in cosmetic products. Its ability to stabilize emulsions and chelate metal ions helps to improve the texture, stability, and shelf life of cosmetics.
Used as a pH Adjuster:
(2-Hydroxyethyl)ammonium hydrogen tartrate is used as a pH adjuster in various topical and oral medications. Its ability to regulate pH levels helps to maintain the stability and effectiveness of these medications, making them safe for use.
Overall, (2-Hydroxyethyl)ammonium hydrogen tartrate is an important chemical in the pharmaceutical and cosmetic industries due to its versatile properties and applications in various formulations.
Check Digit Verification of cas no
The CAS Registry Mumber 17598-15-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,7,5,9 and 8 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 17598-15:
(7*1)+(6*7)+(5*5)+(4*9)+(3*8)+(2*1)+(1*5)=141
141 % 10 = 1
So 17598-15-1 is a valid CAS Registry Number.
InChI:InChI=1/C4H6O6.C2H7NO/c5-1(3(7)8)2(6)4(9)10;3-1-2-4/h1-2,5-6H,(H,7,8)(H,9,10);4H,1-3H2/p-1
