180863-27-8 Usage
Description
2-Morpholineacetic acid, also known as 2-(Morpholin-2-yl)acetic acid, is an organic compound that features a morpholine ring attached to an acetic acid group. It is a versatile building block in the synthesis of various pharmaceuticals and chemical compounds due to its unique structural properties.
Uses
Used in Pharmaceutical Industry:
2-Morpholineacetic acid is used as a key intermediate in the synthesis of heterocyclic compounds, specifically as BCL-2 inhibitors. BCL-2 is a protein that prevents apoptosis (cell death) and is overexpressed in various types of cancer cells. Inhibiting BCL-2 can lead to the death of these cancer cells and has potential therapeutic applications in cancer treatment.
Additionally, 2-Morpholineacetic acid can be utilized in the development of other pharmaceutical compounds due to its ability to form diverse chemical structures and its compatibility with various functional groups. This makes it a valuable asset in the design and synthesis of new drugs targeting a wide range of medical conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 180863-27-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,8,0,8,6 and 3 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 180863-27:
(8*1)+(7*8)+(6*0)+(5*8)+(4*6)+(3*3)+(2*2)+(1*7)=148
148 % 10 = 8
So 180863-27-8 is a valid CAS Registry Number.
InChI:InChI=1/C6H11NO3/c8-6(9)3-5-4-7-1-2-10-5/h5,7H,1-4H2,(H,8,9)