182482-25-3 Usage
Description
2,4,6-Trifluorophenylboronic acid is an organic compound with the chemical formula C6H3BF3O2. It is an off-white crystalline solid that is soluble in water and has a molecular weight of 171.91 g/mol. 2,4,6-Trifluorophenylboronic acid is characterized by the presence of three fluorine atoms attached to a phenyl ring, with a boronic acid group attached to the ring as well. The trifluorophenylboronic acid is a versatile building block in organic synthesis and has various applications in different industries.
Uses
Used in Chemical Synthesis:
2,4,6-Trifluorophenylboronic acid is used as a reactant in various chemical reactions for the synthesis of different organic compounds. It is particularly useful in the Suzuki reaction, a type of cross-coupling reaction that allows the formation of carbon-carbon bonds between an aryl or vinyl halide and an organoboron compound.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2,4,6-Trifluorophenylboronic acid is used as a building block for the synthesis of various pharmaceutical compounds. Its unique structure and reactivity make it a valuable component in the development of new drugs with potential therapeutic applications.
Used in Material Science:
2,4,6-Trifluorophenylboronic acid is also used in material science for the synthesis of advanced materials with specific properties. Its ability to form stable covalent bonds with other molecules makes it a useful component in the development of new materials with applications in various fields, such as electronics, energy storage, and nanotechnology.
Used in Enantioselective Borane Reduction:
2,4,6-Trifluorophenylboronic acid is used as a reactant in enantioselective borane reduction reactions. This process allows for the selective reduction of prochiral ketones to chiral alcohols, which is an important aspect in the synthesis of enantiomerically pure compounds with potential applications in pharmaceuticals and agrochemicals.
Used in Suzuki-Miyaura Coupling Reactions:
2,4,6-Trifluorophenylboronic acid is used as a reactant in Suzuki-Miyaura coupling reactions with aryl chlorides and unstable polyfluorophenyl compounds. This reaction allows for the formation of carbon-carbon bonds between these compounds, enabling the synthesis of complex organic molecules with potential applications in various industries.
Used in Synthesis of Phenylboronic Catechol Esters:
2,4,6-Trifluorophenylboronic acid is used as a reactant in the synthesis of phenylboronic catechol esters. These esters have potential applications in the development of new materials with unique properties, such as self-healing materials and sensors.
Check Digit Verification of cas no
The CAS Registry Mumber 182482-25-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,8,2,4,8 and 2 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 182482-25:
(8*1)+(7*8)+(6*2)+(5*4)+(4*8)+(3*2)+(2*2)+(1*5)=143
143 % 10 = 3
So 182482-25-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H4BF3O2/c8-3-1-2-4(9)6(10)5(3)7(11)12/h1-2,11-12H
182482-25-3Relevant articles and documents
Synthetic method for 2,4,6-trifluorophenol
-
Paragraph 0021-0023; 0025, (2019/04/04)
The invention relates to the technical field of organic synthesis, in particular to a synthetic method for 2,4,6-trifluorophenol. The synthetic method comprises the following steps of (1) sequentiallyperforming hydrogen removal reaction and reaction with
Polyfluoroorganoboron-oxygen compounds. 1: Polyfluorinated aryl(dihydroxy)boranes and tri(aryl)boroxins
Frohn,Adonin,Bardin,Starichenko
, p. 2827 - 2833 (2008/10/08)
A general preparative procedure for polyfluorinated aryl(dihydroxy)boranes C6H5-nFnB(OH)2 (n = 3 - 5) is described. Polyfluorinated aryl(dihydroxy)boranes are easily dehydrated to the corresponding tri(aryl)boroxins (C6H5-nFnBO)3 by thermal or chemical treatment. The property of the acids C6H5-nFnB(OH)2 to condensate depends on the number and on the position of the fluorine atoms in the aryl group. Examples of both classes of boron compounds were isolated as pure individuals and characterized by multinuclear NMR spectroscopy.
