18436-69-6 Usage
General Description
ETHYL 4-CHLOROQUINOLINE-2-CARBOXYLATE is a chemical compound with the molecular formula C13H10ClNO2. It is a derivative of quinoline and carboxylic acid, and its structure contains a chlorine atom attached to the 4th carbon of the quinoline ring. ETHYL 4-CHLOROQUINOLINE-2-CARBOXYLATE is commonly used in the pharmaceutical industry for the synthesis of various drugs, particularly those with antimalarial, antibacterial, and antifungal properties. Its carboxylate group makes it useful for the development of prodrugs, as it can be easily metabolized in the body to release the active drug. Additionally, it has potential applications in the field of organic synthesis and drug discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 18436-69-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,8,4,3 and 6 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 18436-69:
(7*1)+(6*8)+(5*4)+(4*3)+(3*6)+(2*6)+(1*9)=126
126 % 10 = 6
So 18436-69-6 is a valid CAS Registry Number.
InChI:InChI=1/C12H10ClNO2/c1-2-16-12(15)11-7-9(13)8-5-3-4-6-10(8)14-11/h3-7H,2H2,1H3
