1854-42-8 Usage
General Description
4-Amino-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine is a chemical compound with the molecular formula C6H7N5. It is a heterocyclic compound containing a fused pyrrolopyrimidine ring system. 4-Amino-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine is a key intermediate in the synthesis of various pharmaceuticals, including antiviral and anticancer agents such as Tenofovir and Raltegravir. It is also used as a building block in organic synthesis for the preparation of diverse pyrrolopyrimidine derivatives. Its unique structure and versatile reactivity make it a valuable compound in the field of medicinal chemistry and drug development.
Check Digit Verification of cas no
The CAS Registry Mumber 1854-42-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,8,5 and 4 respectively; the second part has 2 digits, 4 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 1854-42:
(6*1)+(5*8)+(4*5)+(3*4)+(2*4)+(1*2)=88
88 % 10 = 8
So 1854-42-8 is a valid CAS Registry Number.
InChI:InChI=1/C6H8N4/c7-6-4-1-8-2-5(4)9-3-10-6/h3,8H,1-2H2,(H2,7,9,10)