185416-17-5 Usage
Description
3,5-Dimethyl-4-methoxyphenylmagnesium bromide is an organometallic compound characterized by its unique structure, which features two methyl groups at the 3rd and 5th positions, and a methoxy group at the 4th position on a phenyl ring, with a magnesium bromide moiety attached. 3,5-dimethyl-4-methoxyphenylmagnesium bromide is known for its reactivity and is widely utilized in various chemical reactions due to its ability to form carbon-carbon and carbon-heteroatom bonds.
Uses
Used in Organic Synthesis:
3,5-Dimethyl-4-methoxyphenylmagnesium bromide is used as a key intermediate for the synthesis of complex organic molecules. Its reactivity allows for the formation of new carbon-carbon and carbon-heteroatom bonds, which are essential in constructing a wide range of organic compounds.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 3,5-dimethyl-4-methoxyphenylmagnesium bromide is used as a building block for the development of new drugs. Its unique structure and reactivity enable the creation of novel molecular frameworks that can potentially exhibit therapeutic properties.
Used in Agrochemicals:
3,5-Dimethyl-4-methoxyphenylmagnesium bromide is employed as a starting material in the synthesis of various agrochemicals, such as pesticides and herbicides. Its incorporation into these compounds can lead to improved efficacy and selectivity, ultimately contributing to more effective crop protection.
Used in Dyestuff Industry:
In the dyestuff industry, 3,5-dimethyl-4-methoxyphenylmagnesium bromide is utilized as a precursor for the production of various dyes and pigments. Its unique structure and reactivity contribute to the development of dyes with specific color properties and improved stability.
Check Digit Verification of cas no
The CAS Registry Mumber 185416-17-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,8,5,4,1 and 6 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 185416-17:
(8*1)+(7*8)+(6*5)+(5*4)+(4*1)+(3*6)+(2*1)+(1*7)=145
145 % 10 = 5
So 185416-17-5 is a valid CAS Registry Number.
InChI:InChI=1/C9H11O.BrH.Mg/c1-7-5-4-6-8(2)9(7)10-3;;/h5-6H,1-3H3;1H;/q;;+1/p-1/rC9H11BrMgO/c1-6-4-8(11-10)5-7(2)9(6)12-3/h4-5H,1-3H3